C13H14N4O2S2 — CID 35353678
N-[2-oxo-2-(propylamino)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 35353678) has the molecular formula C13H14N4O2S2 and a molecular weight of 322.42 g/mol. Its IUPAC name is N-[2-oxo-2-(propylamino)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-[2-oxo-2-(propylamino)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 35353678 |
| Molecular Formula | C13H14N4O2S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-[2-oxo-2-(propylamino)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | CCCNC(=O)CNC(=O)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C13H14N4O2S2/c1-2-3-14-10(18)7-15-11(19)9-6-8-12(21-9)16-13-17(8)4-5-20-13/h4-6H,2-3,7H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | JXNCMKZVFBZFMY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |