C16H13N3O2S2 — CID 32736162
N-[(2-methoxyphenyl)methyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 32736162) has the molecular formula C16H13N3O2S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 32736162 |
| Molecular Formula | C16H13N3O2S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C16H13N3O2S2/c1-21-12-5-3-2-4-10(12)9-17-14(20)13-8-11-15(23-13)18-16-19(11)6-7-22-16/h2-8H,9H2,1H3,(H,17,20) |
| InChIKey | NCLKBQVIWBGOMD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |