C18H17N3O3S2 — CID 134053751
N-[1-(2,4-dimethoxyphenyl)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 134053751) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is N-[1-(2,4-dimethoxyphenyl)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-[1-(2,4-dimethoxyphenyl)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 134053751 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-[1-(2,4-dimethoxyphenyl)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)c2cc3c(nc4sccn43)s2)c(OC)c1 |
| InChI | InChI=1S/C18H17N3O3S2/c1-10(12-5-4-11(23-2)8-14(12)24-3)19-16(22)15-9-13-17(26-15)20-18-21(13)6-7-25-18/h4-10H,1-3H3,(H,19,22) |
| InChIKey | HXQHGXDHVBSIEL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |