C15H11N3O2S2 — CID 32728329
N-(4-methoxyphenyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 32728329) has the molecular formula C15H11N3O2S2 and a molecular weight of 329.41 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 32728329 |
| Molecular Formula | C15H11N3O2S2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-(4-methoxyphenyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3c(nc4sccn43)s2)cc1 |
| InChI | InChI=1S/C15H11N3O2S2/c1-20-10-4-2-9(3-5-10)16-13(19)12-8-11-14(22-12)17-15-18(11)6-7-21-15/h2-8H,1H3,(H,16,19) |
| InChIKey | ABZTVNREIOXKAR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |