C15H11N3OS3 — CID 35826986
N-(3-methylsulfanylphenyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 35826986) has the molecular formula C15H11N3OS3 and a molecular weight of 345.47 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-(3-methylsulfanylphenyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 35826986 |
| Molecular Formula | C15H11N3OS3 |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | CSc1cccc(NC(=O)c2cc3c(nc4sccn43)s2)c1 |
| InChI | InChI=1S/C15H11N3OS3/c1-20-10-4-2-3-9(7-10)16-13(19)12-8-11-14(22-12)17-15-18(11)5-6-21-15/h2-8H,1H3,(H,16,19) |
| InChIKey | OMMUPNULNMSMHL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |