C13H15N3O2S3 — CID 103801249
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 103801249) has the molecular formula C13H15N3O2S3 and a molecular weight of 341.48 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 103801249 |
| Molecular Formula | C13H15N3O2S3 |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | CSC(CO)C(C)NC(=O)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C13H15N3O2S3/c1-7(10(6-17)19-2)14-11(18)9-5-8-12(21-9)15-13-16(8)3-4-20-13/h3-5,7,10,17H,6H2,1-2H3,(H,14,18) |
| InChIKey | WYMSMTYOJCNIBZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |