C12H11N3O4S2 — CID 104964376
(2S,3R)-2-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonylamino)-3-hydroxybutanoic acid (PubChem CID 104964376) has the molecular formula C12H11N3O4S2 and a molecular weight of 325.37 g/mol. Its IUPAC name is (2S,3R)-2-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104964376 |
| Molecular Formula | C12H11N3O4S2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | (2S,3R)-2-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonylamino)-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1cc2c(nc3sccn32)s1)C(=O)O |
| InChI | InChI=1S/C12H11N3O4S2/c1-5(16)8(11(18)19)13-9(17)7-4-6-10(21-7)14-12-15(6)2-3-20-12/h2-5,8,16H,1H3,(H,13,17)(H,18,19)/t5-,8+/m1/s1 |
| InChIKey | PDUXZJNNXTXZAL-XRGYYRRGSA-N |
| XLogP | 1.17 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |