C19H15N3O3S2 — CID 30582350
N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 30582350) has the molecular formula C19H15N3O3S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 30582350 |
| Molecular Formula | C19H15N3O3S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OC1(CCCC1)O2)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C19H15N3O3S2/c23-16(15-10-12-17(27-15)21-18-22(12)7-8-26-18)20-11-3-4-13-14(9-11)25-19(24-13)5-1-2-6-19/h3-4,7-10H,1-2,5-6H2,(H,20,23) |
| InChIKey | LLRUZJGRBDYHJL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |