C15H9N5OS5 — CID 55437872
N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 55437872) has the molecular formula C15H9N5OS5 and a molecular weight of 435.61 g/mol. Its IUPAC name is N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 55437872 |
| Molecular Formula | C15H9N5OS5 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 434.94 |
| IUPAC Name | N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2cccs2)s1)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C15H9N5OS5/c21-11(10-6-9-12(25-10)17-14-20(9)3-5-23-14)16-13-18-19-15(26-13)24-7-8-2-1-4-22-8/h1-6H,7H2,(H,16,18,21) |
| InChIKey | NMJAWOQWWLIZSE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|