C21H17N5OS4 — CID 112773120
1-benzyl-3-methyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 112773120) has the molecular formula C21H17N5OS4 and a molecular weight of 483.67 g/mol. Its IUPAC name is 1-benzyl-3-methyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1-benzyl-3-methyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 112773120 |
| Molecular Formula | C21H17N5OS4 |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 1-benzyl-3-methyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c2sc(C(=O)Nc3nnc(SCc4cccs4)s3)cc12 |
| InChI | InChI=1S/C21H17N5OS4/c1-13-16-10-17(30-19(16)26(25-13)11-14-6-3-2-4-7-14)18(27)22-20-23-24-21(31-20)29-12-15-8-5-9-28-15/h2-10H,11-12H2,1H3,(H,22,23,27) |
| InChIKey | KENCETTZZHFUJR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|