C22H16FN5OS3 — CID 16550801
N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 16550801) has the molecular formula C22H16FN5OS3 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 16550801 |
| Molecular Formula | C22H16FN5OS3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)Nc3nnc(SCc4ccccc4F)s3)cc12 |
| InChI | InChI=1S/C22H16FN5OS3/c1-13-16-11-18(31-20(16)28(27-13)15-8-3-2-4-9-15)19(29)24-21-25-26-22(32-21)30-12-14-7-5-6-10-17(14)23/h2-11H,12H2,1H3,(H,24,25,29) |
| InChIKey | QTAVBIPMERGQBJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|