C16H12FN3OS2 — CID 31593515
N-[2-(3-fluorophenyl)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 31593515) has the molecular formula C16H12FN3OS2 and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 31593515 |
| Molecular Formula | C16H12FN3OS2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | O=C(NCCc1cccc(F)c1)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C16H12FN3OS2/c17-11-3-1-2-10(8-11)4-5-18-14(21)13-9-12-15(23-13)19-16-20(12)6-7-22-16/h1-3,6-9H,4-5H2,(H,18,21) |
| InChIKey | KNUYNDKBWFOHKB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |