C16H11F2N3O2S2 — CID 38507025
N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 38507025) has the molecular formula C16H11F2N3O2S2 and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 38507025 |
| Molecular Formula | C16H11F2N3O2S2 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | O=C(NC[C@H](O)c1ccc(F)c(F)c1)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C16H11F2N3O2S2/c17-9-2-1-8(5-10(9)18)12(22)7-19-14(23)13-6-11-15(25-13)20-16-21(11)3-4-24-16/h1-6,12,22H,7H2,(H,19,23)/t12-/m0/s1 |
| InChIKey | LALFXJDUDOAEOZ-LBPRGKRZSA-N |
| XLogP | 3.35 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |