C17H14N4O2S2 — CID 55660763
N-[2-methyl-3-(methylcarbamoyl)phenyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 55660763) has the molecular formula C17H14N4O2S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[2-methyl-3-(methylcarbamoyl)phenyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-[2-methyl-3-(methylcarbamoyl)phenyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 55660763 |
| Molecular Formula | C17H14N4O2S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N-[2-methyl-3-(methylcarbamoyl)phenyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2cc3c(nc4sccn43)s2)c1C |
| InChI | InChI=1S/C17H14N4O2S2/c1-9-10(14(22)18-2)4-3-5-11(9)19-15(23)13-8-12-16(25-13)20-17-21(12)6-7-24-17/h3-8H,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | RQGMCDXKCJNUIO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |