C16H12ClN3OS2 — CID 40656205
N-[(2-chlorophenyl)methyl]-N-methyl-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 40656205) has the molecular formula C16H12ClN3OS2 and a molecular weight of 361.88 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-methyl-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-methyl-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 40656205 |
| Molecular Formula | C16H12ClN3OS2 |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-methyl-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | CN(Cc1ccccc1Cl)C(=O)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C16H12ClN3OS2/c1-19(9-10-4-2-3-5-11(10)17)15(21)13-8-12-14(23-13)18-16-20(12)6-7-22-16/h2-8H,9H2,1H3 |
| InChIKey | AMWKYQMHHHCVFM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |