C17H14N4O3S2 — CID 38603492
N-ethyl-N-[(3-nitrophenyl)methyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 38603492) has the molecular formula C17H14N4O3S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-ethyl-N-[(3-nitrophenyl)methyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-ethyl-N-[(3-nitrophenyl)methyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 38603492 |
| Molecular Formula | C17H14N4O3S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | N-ethyl-N-[(3-nitrophenyl)methyl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C17H14N4O3S2/c1-2-19(10-11-4-3-5-12(8-11)21(23)24)16(22)14-9-13-15(26-14)18-17-20(13)6-7-25-17/h3-9H,2,10H2,1H3 |
| InChIKey | XMXYEKNULOHYHW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|