C18H20N2O3 — CID 142891853
N,N-diethyl-4-[(3-nitrophenyl)methyl]benzamide (PubChem CID 142891853) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N,N-diethyl-4-[(3-nitrophenyl)methyl]benzamide.
| Compound Name | N,N-diethyl-4-[(3-nitrophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 142891853 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N,N-diethyl-4-[(3-nitrophenyl)methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(Cc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H20N2O3/c1-3-19(4-2)18(21)16-10-8-14(9-11-16)12-15-6-5-7-17(13-15)20(22)23/h5-11,13H,3-4,12H2,1-2H3 |
| InChIKey | ZTZYCOCUAVXSGZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|