C18H15ClN4O3S3 — CID 30582347
[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraen-4-yl)methanone (PubChem CID 30582347) has the molecular formula C18H15ClN4O3S3 and a molecular weight of 467.00 g/mol. Its IUPAC name is [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraen-4-yl)methanone.
| Compound Name | [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraen-4-yl)methanone |
|---|---|
| PubChem CID | 30582347 |
| Molecular Formula | C18H15ClN4O3S3 |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraen-4-yl)methanone |
| SMILES | O=C(c1cc2c(nc3sccn32)s1)N1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H15ClN4O3S3/c19-12-3-1-2-4-15(12)29(25,26)22-7-5-21(6-8-22)17(24)14-11-13-16(28-14)20-18-23(13)9-10-27-18/h1-4,9-11H,5-8H2 |
| InChIKey | VYLCNVAVUQGAMW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |