C21H18N4O4S2 — CID 30583227
N-(1,3-benzodioxol-5-yl)-1-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperidine-4-carboxamide (PubChem CID 30583227) has the molecular formula C21H18N4O4S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30583227 |
| Molecular Formula | C21H18N4O4S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCN(C(=O)c2cc3c(nc4sccn43)s2)CC1 |
| InChI | InChI=1S/C21H18N4O4S2/c26-18(22-13-1-2-15-16(9-13)29-11-28-15)12-3-5-24(6-4-12)20(27)17-10-14-19(31-17)23-21-25(14)7-8-30-21/h1-2,7-10,12H,3-6,11H2,(H,22,26) |
| InChIKey | UWHQOEJUDJKWRC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |