C15H19N3O2S2 — CID 32954662
N-(2-methoxyethyl)-N-(2-methylpropyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 32954662) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-(2-methylpropyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-N-(2-methylpropyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 32954662 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(2-methoxyethyl)-N-(2-methylpropyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | COCCN(CC(C)C)C(=O)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C15H19N3O2S2/c1-10(2)9-17(4-6-20-3)14(19)12-8-11-13(22-12)16-15-18(11)5-7-21-15/h5,7-8,10H,4,6,9H2,1-3H3 |
| InChIKey | UGSMWGJMNKGVJK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |