C20H24N4O2S2 — CID 46454889
N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 46454889) has the molecular formula C20H24N4O2S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 46454889 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)C2CCCCC2)CC1)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C20H24N4O2S2/c25-17(16-12-15-18(28-16)22-20-24(15)10-11-27-20)21-14-6-8-23(9-7-14)19(26)13-4-2-1-3-5-13/h10-14H,1-9H2,(H,21,25) |
| InChIKey | KCIAWQXAIFIMML-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |