C20H19ClN4OS2 — CID 55438177
N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 55438177) has the molecular formula C20H19ClN4OS2 and a molecular weight of 430.99 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 55438177 |
| Molecular Formula | C20H19ClN4OS2 |
| Molecular Weight | 430.99 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccc(Cl)cc2)CC1)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C20H19ClN4OS2/c21-14-3-1-13(2-4-14)12-24-7-5-15(6-8-24)22-18(26)17-11-16-19(28-17)23-20-25(16)9-10-27-20/h1-4,9-11,15H,5-8,12H2,(H,22,26) |
| InChIKey | PBBGNSWMORXUMT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.99 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |