C17H18BrClN2OS — CID 46587440
5-bromo-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]thiophene-3-carboxamide (PubChem CID 46587440) has the molecular formula C17H18BrClN2OS and a molecular weight of 413.77 g/mol. Its IUPAC name is 5-bromo-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 46587440 |
| Molecular Formula | C17H18BrClN2OS |
| Molecular Weight | 413.77 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 5-bromo-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]thiophene-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccc(Cl)cc2)CC1)c1csc(Br)c1 |
| InChI | InChI=1S/C17H18BrClN2OS/c18-16-9-13(11-23-16)17(22)20-15-5-7-21(8-6-15)10-12-1-3-14(19)4-2-12/h1-4,9,11,15H,5-8,10H2,(H,20,22) |
| InChIKey | DSYQSKFGUIRWHR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |