C23H24ClN3O3S2 — CID 24504177
N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 24504177) has the molecular formula C23H24ClN3O3S2 and a molecular weight of 490.05 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 24504177 |
| Molecular Formula | C23H24ClN3O3S2 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NC1CCN(Cc2ccc(Cl)cc2)CC1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C23H24ClN3O3S2/c24-19-7-3-17(4-8-19)16-27-13-11-20(12-14-27)25-23(28)18-5-9-21(10-6-18)26-32(29,30)22-2-1-15-31-22/h1-10,15,20,26H,11-14,16H2,(H,25,28) |
| InChIKey | ILZWXLXVGHDFSC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |