C17H19Cl2N3O — CID 18121095
4-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-1H-pyrrole-2-carboxamide (PubChem CID 18121095) has the molecular formula C17H19Cl2N3O and a molecular weight of 352.27 g/mol. Its IUPAC name is 4-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18121095 |
| Molecular Formula | C17H19Cl2N3O |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccc(Cl)cc2)CC1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C17H19Cl2N3O/c18-13-3-1-12(2-4-13)11-22-7-5-15(6-8-22)21-17(23)16-9-14(19)10-20-16/h1-4,9-10,15,20H,5-8,11H2,(H,21,23) |
| InChIKey | MFJOWDVVPWIQOO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |