C18H19BrClN3O — CID 8590020
5-bromo-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 8590020) has the molecular formula C18H19BrClN3O and a molecular weight of 408.73 g/mol. Its IUPAC name is 5-bromo-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 8590020 |
| Molecular Formula | C18H19BrClN3O |
| Molecular Weight | 408.73 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 5-bromo-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccc(Cl)cc2)CC1)c1cncc(Br)c1 |
| InChI | InChI=1S/C18H19BrClN3O/c19-15-9-14(10-21-11-15)18(24)22-17-5-7-23(8-6-17)12-13-1-3-16(20)4-2-13/h1-4,9-11,17H,5-8,12H2,(H,22,24) |
| InChIKey | KDIULTHNAGSYHA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |