C13H16BrIN2O — CID 78769373
(5-bromo-2-iodophenyl)-(4-methyl-1,4-diazepan-1-yl)methanone (PubChem CID 78769373) has the molecular formula C13H16BrIN2O and a molecular weight of 423.09 g/mol. Its IUPAC name is (5-bromo-2-iodophenyl)-(4-methyl-1,4-diazepan-1-yl)methanone.
| Compound Name | (5-bromo-2-iodophenyl)-(4-methyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 78769373 |
| Molecular Formula | C13H16BrIN2O |
| Molecular Weight | 423.09 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | (5-bromo-2-iodophenyl)-(4-methyl-1,4-diazepan-1-yl)methanone |
| SMILES | CN1CCCN(C(=O)c2cc(Br)ccc2I)CC1 |
| InChI | InChI=1S/C13H16BrIN2O/c1-16-5-2-6-17(8-7-16)13(18)11-9-10(14)3-4-12(11)15/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | PXMRZSDTPWKFLH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.09 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|