C23H20N4O3S2 — CID 29176284
ethyl 2-[[5-[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 29176284) has the molecular formula C23H20N4O3S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 29176284 |
| Molecular Formula | C23H20N4O3S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | ethyl 2-[[5-[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2cc(-c3ccc(C)cc3)nc3ccccc23)s1 |
| InChI | InChI=1S/C23H20N4O3S2/c1-3-30-20(28)13-31-23-27-26-22(32-23)25-21(29)17-12-19(15-10-8-14(2)9-11-15)24-18-7-5-4-6-16(17)18/h4-12H,3,13H2,1-2H3,(H,25,26,29) |
| InChIKey | YXOVIBKNOOPWRX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|