C13H11IN4O5S2 — CID 38905830
ethyl 2-[[5-[(2-iodo-5-nitrobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 38905830) has the molecular formula C13H11IN4O5S2 and a molecular weight of 494.29 g/mol. Its IUPAC name is ethyl 2-[[5-[(2-iodo-5-nitrobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[(2-iodo-5-nitrobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 38905830 |
| Molecular Formula | C13H11IN4O5S2 |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 493.92 |
| IUPAC Name | ethyl 2-[[5-[(2-iodo-5-nitrobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2cc([N+](=O)[O-])ccc2I)s1 |
| InChI | InChI=1S/C13H11IN4O5S2/c1-2-23-10(19)6-24-13-17-16-12(25-13)15-11(20)8-5-7(18(21)22)3-4-9(8)14/h3-5H,2,6H2,1H3,(H,15,16,20) |
| InChIKey | PBHNOTPXOZYTOY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|