C15H17N5OS2 — CID 17473566
2-(2-ethylbenzimidazol-1-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 17473566) has the molecular formula C15H17N5OS2 and a molecular weight of 347.47 g/mol. Its IUPAC name is 2-(2-ethylbenzimidazol-1-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(2-ethylbenzimidazol-1-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17473566 |
| Molecular Formula | C15H17N5OS2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-(2-ethylbenzimidazol-1-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)Cn2c(CC)nc3ccccc32)s1 |
| InChI | InChI=1S/C15H17N5OS2/c1-3-12-16-10-7-5-6-8-11(10)20(12)9-13(21)17-14-18-19-15(23-14)22-4-2/h5-8H,3-4,9H2,1-2H3,(H,17,18,21) |
| InChIKey | UYHNPXFDGIDDFV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|