C16H17N5O3S2 — CID 17432004
2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 17432004) has the molecular formula C16H17N5O3S2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17432004 |
| Molecular Formula | C16H17N5O3S2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)Cn2c(=O)n(CC)c(=O)c3ccccc32)s1 |
| InChI | InChI=1S/C16H17N5O3S2/c1-3-20-13(23)10-7-5-6-8-11(10)21(16(20)24)9-12(22)17-14-18-19-15(26-14)25-4-2/h5-8H,3-4,9H2,1-2H3,(H,17,18,22) |
| InChIKey | VNMNJMINKGKGPB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|