C16H17FN4O4S2 — CID 55827803
ethyl 2-[[5-[[2-[[2-(3-fluorophenyl)acetyl]amino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 55827803) has the molecular formula C16H17FN4O4S2 and a molecular weight of 412.47 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-[[2-(3-fluorophenyl)acetyl]amino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-[[2-(3-fluorophenyl)acetyl]amino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 55827803 |
| Molecular Formula | C16H17FN4O4S2 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | ethyl 2-[[5-[[2-[[2-(3-fluorophenyl)acetyl]amino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)CNC(=O)Cc2cccc(F)c2)s1 |
| InChI | InChI=1S/C16H17FN4O4S2/c1-2-25-14(24)9-26-16-21-20-15(27-16)19-13(23)8-18-12(22)7-10-4-3-5-11(17)6-10/h3-6H,2,7-9H2,1H3,(H,18,22)(H,19,20,23) |
| InChIKey | XBIROUVWBOZGMZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|