C17H18N6OS3 — CID 133108698
N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(triazolidin-4-ylsulfanyl)acetamide (PubChem CID 133108698) has the molecular formula C17H18N6OS3 and a molecular weight of 418.57 g/mol. Its IUPAC name is N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(triazolidin-4-ylsulfanyl)acetamide.
| Compound Name | N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(triazolidin-4-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 133108698 |
| Molecular Formula | C17H18N6OS3 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(triazolidin-4-ylsulfanyl)acetamide |
| SMILES | O=C(CSC1CNNN1)Nc1nnc(SCc2cccc3ccccc23)s1 |
| InChI | InChI=1S/C17H18N6OS3/c24-14(10-25-15-8-18-23-20-15)19-16-21-22-17(27-16)26-9-12-6-3-5-11-4-1-2-7-13(11)12/h1-7,15,18,20,23H,8-10H2,(H,19,21,24) |
| InChIKey | LRIMOZJGFKGWLY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|