C23H17F3N4O3S2 — CID 44956448
2-naphthalen-1-yl-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 44956448) has the molecular formula C23H17F3N4O3S2 and a molecular weight of 518.54 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-naphthalen-1-yl-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 44956448 |
| Molecular Formula | C23H17F3N4O3S2 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 2-naphthalen-1-yl-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(CSc1nnc(NC(=O)Cc2cccc3ccccc23)s1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F3N4O3S2/c24-23(25,26)33-17-10-8-16(9-11-17)27-20(32)13-34-22-30-29-21(35-22)28-19(31)12-15-6-3-5-14-4-1-2-7-18(14)15/h1-11H,12-13H2,(H,27,32)(H,28,29,31) |
| InChIKey | XCSKNDGMJBKNMP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|