C25H20N4O2S5 — CID 18864973
N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide (PubChem CID 18864973) has the molecular formula C25H20N4O2S5 and a molecular weight of 568.80 g/mol. Its IUPAC name is N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 18864973 |
| Molecular Formula | C25H20N4O2S5 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.02 |
| IUPAC Name | N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)/C(=C/c2cccs2)SC1=S)Nc1nnc(SCc2cccc3ccccc23)s1 |
| InChI | InChI=1S/C25H20N4O2S5/c30-21(11-4-12-29-22(31)20(35-25(29)32)14-18-9-5-13-33-18)26-23-27-28-24(36-23)34-15-17-8-3-7-16-6-1-2-10-19(16)17/h1-3,5-10,13-14H,4,11-12,15H2,(H,26,27,30)/b20-14- |
| InChIKey | BFISFQCTAQSZGH-ZHZULCJRSA-N |
| XLogP | 6.67 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|