C21H17FN4O2S5 — CID 18864818
N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide (PubChem CID 18864818) has the molecular formula C21H17FN4O2S5 and a molecular weight of 536.73 g/mol. Its IUPAC name is N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 18864818 |
| Molecular Formula | C21H17FN4O2S5 |
| Molecular Weight | 536.73 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)/C(=C/c2cccs2)SC1=S)Nc1nnc(SCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C21H17FN4O2S5/c22-14-7-5-13(6-8-14)12-31-20-25-24-19(33-20)23-17(27)4-1-9-26-18(28)16(32-21(26)29)11-15-3-2-10-30-15/h2-3,5-8,10-11H,1,4,9,12H2,(H,23,24,27)/b16-11- |
| InChIKey | WIOOVEXMOHCCGY-WJDWOHSUSA-N |
| XLogP | 5.65 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.73 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|