C23H19FN4O2S4 — CID 18864701
3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 18864701) has the molecular formula C23H19FN4O2S4 and a molecular weight of 530.70 g/mol. Its IUPAC name is 3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 18864701 |
| Molecular Formula | C23H19FN4O2S4 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | 3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | Cc1ccccc1CSc1nnc(NC(=O)CCN2C(=O)/C(=C/c3ccc(F)cc3)SC2=S)s1 |
| InChI | InChI=1S/C23H19FN4O2S4/c1-14-4-2-3-5-16(14)13-32-22-27-26-21(34-22)25-19(29)10-11-28-20(30)18(33-23(28)31)12-15-6-8-17(24)9-7-15/h2-9,12H,10-11,13H2,1H3,(H,25,26,29)/b18-12- |
| InChIKey | IFOYPRBXPZEJHX-PDGQHHTCSA-N |
| XLogP | 5.51 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|