C12H10NNaO2S — CID 23698351
sodium 2-(4-methylquinolin-2-yl)sulfanylacetate (PubChem CID 23698351) has the molecular formula C12H10NNaO2S and a molecular weight of 255.27 g/mol. Its IUPAC name is sodium 2-(4-methylquinolin-2-yl)sulfanylacetate.
| Compound Name | sodium 2-(4-methylquinolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 23698351 |
| Molecular Formula | C12H10NNaO2S |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | sodium 2-(4-methylquinolin-2-yl)sulfanylacetate |
| SMILES | Cc1cc(SCC(=O)[O-])nc2ccccc12.[Na+] |
| InChI | InChI=1S/C12H11NO2S.Na/c1-8-6-11(16-7-12(14)15)13-10-5-3-2-4-9(8)10;/h2-6H,7H2,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | GABGHIGCODQLLB-UHFFFAOYSA-M |
| XLogP | -1.61 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |