C20H26FN3O3S — CID 56533673
[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone (PubChem CID 56533673) has the molecular formula C20H26FN3O3S and a molecular weight of 407.51 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone.
| Compound Name | [1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 56533673 |
| Molecular Formula | C20H26FN3O3S |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCN(CCS(C)(=O)=O)CC2)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C20H26FN3O3S/c1-15-14-17(16(2)24(15)19-7-5-4-6-18(19)21)20(25)23-10-8-22(9-11-23)12-13-28(3,26)27/h4-7,14H,8-13H2,1-3H3 |
| InChIKey | HYKGRQZESLTAME-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|