C27H31FN4O2 — CID 37213673
N-(2,6-dimethylphenyl)-2-[4-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperazin-1-yl]acetamide (PubChem CID 37213673) has the molecular formula C27H31FN4O2 and a molecular weight of 462.57 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 37213673 |
| Molecular Formula | C27H31FN4O2 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCN(C(=O)c2cc(C)n(-c3ccccc3F)c2C)CC1 |
| InChI | InChI=1S/C27H31FN4O2/c1-18-8-7-9-19(2)26(18)29-25(33)17-30-12-14-31(15-13-30)27(34)22-16-20(3)32(21(22)4)24-11-6-5-10-23(24)28/h5-11,16H,12-15,17H2,1-4H3,(H,29,33) |
| InChIKey | VJGHIGZOSPQSDX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|