C27H29F3N4O2 — CID 39760038
2-[4-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 39760038) has the molecular formula C27H29F3N4O2 and a molecular weight of 498.55 g/mol. Its IUPAC name is 2-[4-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 39760038 |
| Molecular Formula | C27H29F3N4O2 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2-[4-[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccccc1-n1c(C)cc(C(=O)N2CCN(CC(=O)Nc3ccccc3C(F)(F)F)CC2)c1C |
| InChI | InChI=1S/C27H29F3N4O2/c1-18-8-4-7-11-24(18)34-19(2)16-21(20(34)3)26(36)33-14-12-32(13-15-33)17-25(35)31-23-10-6-5-9-22(23)27(28,29)30/h4-11,16H,12-15,17H2,1-3H3,(H,31,35) |
| InChIKey | KCJVBOSHTIPTKY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|