C16H20F2N2O3S — CID 72687142
3-(2,6-difluorophenyl)-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 72687142) has the molecular formula C16H20F2N2O3S and a molecular weight of 358.41 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(2,6-difluorophenyl)-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 72687142 |
| Molecular Formula | C16H20F2N2O3S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 3-(2,6-difluorophenyl)-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CS(=O)(=O)CCN1CCN(C(=O)C=Cc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C16H20F2N2O3S/c1-24(22,23)12-11-19-7-9-20(10-8-19)16(21)6-5-13-14(17)3-2-4-15(13)18/h2-6H,7-12H2,1H3 |
| InChIKey | JNLXWSLLDRJESD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|