C18H22ClFN2O — CID 23657966
(2E,4E)-1-[4-(3-chloropropyl)piperazin-1-yl]-5-(2-fluorophenyl)penta-2,4-dien-1-one (PubChem CID 23657966) has the molecular formula C18H22ClFN2O and a molecular weight of 336.84 g/mol. Its IUPAC name is (2E,4E)-1-[4-(3-chloropropyl)piperazin-1-yl]-5-(2-fluorophenyl)penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-[4-(3-chloropropyl)piperazin-1-yl]-5-(2-fluorophenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 23657966 |
| Molecular Formula | C18H22ClFN2O |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (2E,4E)-1-[4-(3-chloropropyl)piperazin-1-yl]-5-(2-fluorophenyl)penta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccccc1F)N1CCN(CCCCl)CC1 |
| InChI | InChI=1S/C18H22ClFN2O/c19-10-5-11-21-12-14-22(15-13-21)18(23)9-4-2-7-16-6-1-3-8-17(16)20/h1-4,6-9H,5,10-15H2/b7-2+,9-4+ |
| InChIKey | JJUWYPRAUGXXGP-TUXQVTDXSA-N |
| XLogP | 3.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|