C15H21FN4O — CID 108904315
4-(2-aminoethyl)-N-[(E)-2-(2-fluorophenyl)ethenyl]piperazine-1-carboxamide (PubChem CID 108904315) has the molecular formula C15H21FN4O and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-[(E)-2-(2-fluorophenyl)ethenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-aminoethyl)-N-[(E)-2-(2-fluorophenyl)ethenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108904315 |
| Molecular Formula | C15H21FN4O |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 4-(2-aminoethyl)-N-[(E)-2-(2-fluorophenyl)ethenyl]piperazine-1-carboxamide |
| SMILES | NCCN1CCN(C(=O)N/C=C/c2ccccc2F)CC1 |
| InChI | InChI=1S/C15H21FN4O/c16-14-4-2-1-3-13(14)5-7-18-15(21)20-11-9-19(8-6-17)10-12-20/h1-5,7H,6,8-12,17H2,(H,18,21)/b7-5+ |
| InChIKey | NTKRSFQMEAGTBU-FNORWQNLSA-N |
| XLogP | 1.08 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |