C11H13FN2O — CID 108904341
1-ethyl-3-[(E)-2-(2-fluorophenyl)ethenyl]urea (PubChem CID 108904341) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-2-(2-fluorophenyl)ethenyl]urea.
| Compound Name | 1-ethyl-3-[(E)-2-(2-fluorophenyl)ethenyl]urea |
|---|---|
| PubChem CID | 108904341 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-ethyl-3-[(E)-2-(2-fluorophenyl)ethenyl]urea |
| SMILES | CCNC(=O)N/C=C/c1ccccc1F |
| InChI | InChI=1S/C11H13FN2O/c1-2-13-11(15)14-8-7-9-5-3-4-6-10(9)12/h3-8H,2H2,1H3,(H2,13,14,15)/b8-7+ |
| InChIKey | JXRRCSIKMVGNLV-BQYQJAHWSA-N |
| XLogP | 2.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |