C17H17FN2O — CID 108904298
1-(2,3-dimethylphenyl)-3-[(E)-2-(2-fluorophenyl)ethenyl]urea (PubChem CID 108904298) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(E)-2-(2-fluorophenyl)ethenyl]urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(E)-2-(2-fluorophenyl)ethenyl]urea |
|---|---|
| PubChem CID | 108904298 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(E)-2-(2-fluorophenyl)ethenyl]urea |
| SMILES | Cc1cccc(NC(=O)N/C=C/c2ccccc2F)c1C |
| InChI | InChI=1S/C17H17FN2O/c1-12-6-5-9-16(13(12)2)20-17(21)19-11-10-14-7-3-4-8-15(14)18/h3-11H,1-2H3,(H2,19,20,21)/b11-10+ |
| InChIKey | MVGPFAROLIFMOW-ZHACJKMWSA-N |
| XLogP | 4.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |