C15H12ClFN2O — CID 108904209
1-(2-chlorophenyl)-3-[(E)-2-(2-fluorophenyl)ethenyl]urea (PubChem CID 108904209) has the molecular formula C15H12ClFN2O and a molecular weight of 290.73 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(E)-2-(2-fluorophenyl)ethenyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[(E)-2-(2-fluorophenyl)ethenyl]urea |
|---|---|
| PubChem CID | 108904209 |
| Molecular Formula | C15H12ClFN2O |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(E)-2-(2-fluorophenyl)ethenyl]urea |
| SMILES | O=C(N/C=C/c1ccccc1F)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H12ClFN2O/c16-12-6-2-4-8-14(12)19-15(20)18-10-9-11-5-1-3-7-13(11)17/h1-10H,(H2,18,19,20)/b10-9+ |
| InChIKey | MWBWHKCBMWGCLW-MDZDMXLPSA-N |
| XLogP | 4.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |