C15H14FN3O — CID 108904487
1-[(E)-2-(2-fluorophenyl)ethenyl]-3-(4-methyl-2-pyridinyl)urea (PubChem CID 108904487) has the molecular formula C15H14FN3O and a molecular weight of 271.30 g/mol. Its IUPAC name is 1-[(E)-2-(2-fluorophenyl)ethenyl]-3-(4-methyl-2-pyridinyl)urea.
| Compound Name | 1-[(E)-2-(2-fluorophenyl)ethenyl]-3-(4-methyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 108904487 |
| Molecular Formula | C15H14FN3O |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-[(E)-2-(2-fluorophenyl)ethenyl]-3-(4-methyl-2-pyridinyl)urea |
| SMILES | Cc1ccnc(NC(=O)N/C=C/c2ccccc2F)c1 |
| InChI | InChI=1S/C15H14FN3O/c1-11-6-8-17-14(10-11)19-15(20)18-9-7-12-4-2-3-5-13(12)16/h2-10H,1H3,(H2,17,18,19,20)/b9-7+ |
| InChIKey | MYXCFWSDQWTHDE-VQHVLOKHSA-N |
| XLogP | 3.32 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |