C19H22N2O5S — CID 40607792
cis-[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate (PubChem CID 40607792) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is cis-[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate.
| Compound Name | cis-[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 40607792 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | cis-[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)[C@@H]2C[C@@H]2C)c(C)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-11-8-16(11)19(23)26-10-18(22)17-9-12(2)21(13(17)3)14-4-6-15(7-5-14)27(20,24)25/h4-7,9,11,16H,8,10H2,1-3H3,(H2,20,24,25)/t11-,16+/m0/s1 |
| InChIKey | USJURONIWHYKAY-MEDUHNTESA-N |
| XLogP | 2.12 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|