C23H21N3O6S2 — CID 42985082
[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 42985082) has the molecular formula C23H21N3O6S2 and a molecular weight of 499.57 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 42985082 |
| Molecular Formula | C23H21N3O6S2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc3c(c2)NC(=O)CS3)c(C)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H21N3O6S2/c1-13-9-18(14(2)26(13)16-4-6-17(7-5-16)34(24,30)31)20(27)11-32-23(29)15-3-8-21-19(10-15)25-22(28)12-33-21/h3-10H,11-12H2,1-2H3,(H,25,28)(H2,24,30,31) |
| InChIKey | YTDYXFNSJXVRCH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 137.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|